Online Database of Chemicals from Around the World
|
CAS#: 95463-62-0 Product: 1',2'-Dihydro-6-Hydroxyrotenone No suppilers available for the product. |
| Name | 1',2'-Dihydro-6-Hydroxyrotenone |
|---|---|
| Synonyms | 1',2'-Dihydro-6-Hydroxyrotenone; Dh-6-Oh-Rotenone |
| Molecular Structure |  |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 |
| CAS Registry Number | 95463-62-0 |
| SMILES | [C@H]1(OC5=C(C1)C4=C(C([C@]3(C2=C(C=C(C(=C2)OC)OC)OC[C@H]3O4)O)=O)C=C5)C(C)C |
| InChI | 1S/C23H24O7/c1-11(2)16-7-13-15(29-16)6-5-12-21(13)30-20-10-28-17-9-19(27-4)18(26-3)8-14(17)23(20,25)22(12)24/h5-6,8-9,11,16,20,25H,7,10H2,1-4H3/t16-,20-,23-/m1/s1 |
| InChIKey | YWJDTVOUNFWLON-AYPBNUJASA-N |
| Density | 1.336g/cm3 (Cal.) |
|---|---|
| Boiling point | 615.79°C at 760 mmHg (Cal.) |
| Flash point | 215.403°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1',2'-Dihydro-6-Hydroxyrotenone |