Online Database of Chemicals from Around the World
|
CAS#: 955038-21-8 Product: [3-Fluoro-5-(trifluoromethyl)phenyl]acetaldehyde No suppilers available for the product. |
| Name | [3-Fluoro-5-(trifluoromethyl)phenyl]acetaldehyde |
|---|---|
| Synonyms | [3-Fluor-5-(trifluormethyl)phenyl]acetaldehyd; [3-Fluoro-5-(trifluoromethyl)phenyl]acetaldehyde; [3-Fluoro-5-(trifluorométhyl)phényl]acétaldéhyde |
| Molecular Structure | ![CAS#: 955038-21-8， [3-Fluoro-5-(trifluoromethyl)phenyl]acetaldehyde](/moreStructures/955038-21-8.gif) |
| Molecular Formula | C9H6F4O |
| Molecular Weight | 206.14 |
| CAS Registry Number | 955038-21-8 |
| SMILES | c1c(cc(cc1C(F)(F)F)F)CC=O |
| InChI | 1S/C9H6F4O/c10-8-4-6(1-2-14)3-7(5-8)9(11,12)13/h2-5H,1H2 |
| InChIKey | LQROJIVWCSJFNQ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 191.1±35.0°C at 760 mmHg (Cal.) |
| Flash point | 70.4±20.1°C (Cal.) |
| Refractive index | 1.434 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3-Fluoro-5-(trifluoromethyl)phenyl]acetaldehyde |