Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-Ethynyl-3,5-dinitrobenzene |
|---|---|
| Synonyms | 3,5-Dinitrophenylacetylene |
| Molecular Structure |  |
| Molecular Formula | C8H4N2O4 |
| Molecular Weight | 192.13 |
| CAS Registry Number | 95577-54-1 |
| SMILES | C#Cc1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C8H4N2O4/c1-2-6-3-7(9(11)12)5-8(4-6)10(13)14/h1,3-5H |
| InChIKey | QXWAGROOHKRYKC-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.716°C at 760 mmHg (Cal.) |
| Flash point | 146.997°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethynyl-3,5-dinitrobenzene |