|
CAS#: 957061-07-3 Product: 2,2'-[1,2-Ethanediylbis(oxy-4,1-phenylene)]bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane) No suppilers available for the product. |
| Name | 2,2'-[1,2-Ethanediylbis(oxy-4,1-phenylene)]bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane) |
|---|---|
| Synonyms | 1,2-Bis[4 |
| Molecular Structure | ![]() |
| Molecular Formula | C26H36B2O6 |
| Molecular Weight | 466.18 |
| CAS Registry Number | 957061-07-3 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)c2ccc(cc2)OCCOc3ccc(cc3)B4OC(C(O4)(C)C)(C)C |
| InChI | 1S/C26H36B2O6/c1-23(2)24(3,4)32-27(31-23)19-9-13-21(14-10-19)29-17-18-30-22-15-11-20(12-16-22)28-33-25(5,6)26(7,8)34-28/h9-16H,17-18H2,1-8H3 |
| InChIKey | WYXYACQNJWQTSI-UHFFFAOYSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 580.146°C at 760 mmHg (Cal.) |
| Flash point | 304.661°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2'-[1,2-Ethanediylbis(oxy-4,1-phenylene)]bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane) |