|
CAS#: 957065-97-3 Product: Methyl 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate No suppilers available for the product. |
| Name | Methyl 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| Synonyms | 3-Nitro-4 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18BNO6 |
| Molecular Weight | 307.11 |
| CAS Registry Number | 957065-97-3 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)c2ccc(cc2[N+](=O)[O-])C(=O)OC |
| InChI | 1S/C14H18BNO6/c1-13(2)14(3,4)22-15(21-13)10-7-6-9(12(17)20-5)8-11(10)16(18)19/h6-8H,1-5H3 |
| InChIKey | WRGJIRHQRSVMFP-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.9±35.0°C at 760 mmHg (Cal.) |
| Flash point | 212.0±25.9°C (Cal.) |
| Refractive index | 1.52 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |