| CAS: 957205-24-2 Product: 4-(Cyclohexyl)-3-(trifluoromethyl)benzyl chloride No suppliers available. |
| Name | 4-(Cyclohexyl)-3-(trifluoromethyl)benzyl chloride |
|---|---|
| Synonyms | 4-(chloromethyl)-1-cyclohexyl-2-(trifluoromethyl)benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16ClF3 |
| Molecular Weight | 276.73 |
| CAS Registry Number | 957205-24-2 |
| SMILES | C1CCC(CC1)C2=C(C=C(C=C2)CCl)C(F)(F)F |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.489, Calc.* |
| Boiling Point | 312.3±37.0 °C (760 mmHg), Calc.* |
| Flash Point | 137.2±18.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H318 Details |
| Safety Statements | P280-P301+P312+P330-P305+P351+P338+P310 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 4-(Cyclohexyl)-3-(trifluoromethyl)benzyl chloride |