Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(Difluoromethyl)-5-oxo-L-proline |
|---|---|
| Synonyms | (S)-2-(difluoromethyl)-5-oxopyrrolidine-2-carboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C6H7F2NO3 |
| Molecular Weight | 179.12 |
| CAS Registry Number | 95755-28-5 |
| SMILES | C1C[C@@](NC1=O)(C(F)F)C(=O)O |
| InChI | 1S/C6H7F2NO3/c7-4(8)6(5(11)12)2-1-3(10)9-6/h4H,1-2H2,(H,9,10)(H,11,12)/t6-/m1/s1 |
| InChIKey | BKGCOXTYIOMIGE-ZCFIWIBFSA-N |
| Density | 1.469g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.136°C at 760 mmHg (Cal.) |
| Flash point | 211.52°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Difluoromethyl)-5-oxo-L-proline |