|
CAS#: 958451-77-9 Product: [2-(Difluoromethoxy)-5-(trifluoromethyl)phenyl]boronic acid No suppilers available for the product. |
| Name | [2-(Difluoromethoxy)-5-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| Synonyms | 2-difluoromethoxy-5-trifluoromethyl-benzeneboronic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6BF5O3 |
| Molecular Weight | 255.93 |
| CAS Registry Number | 958451-77-9 |
| SMILES | B(c1cc(ccc1OC(F)F)C(F)(F)F)(O)O |
| InChI | 1S/C8H6BF5O3/c10-7(11)17-6-2-1-4(8(12,13)14)3-5(6)9(15)16/h1-3,7,15-16H |
| InChIKey | IVGKCBYQINTZRB-UHFFFAOYSA-N |
| Density | 1.484g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.638°C at 760 mmHg (Cal.) |
| Flash point | 147.112°C (Cal.) |
| Refractive index | 1.433 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2-(Difluoromethoxy)-5-(trifluoromethyl)phenyl]boronic acid |