Online Database of Chemicals from Around the World
|
CAS#: 95873-65-7 Product: Tetrahydrofurfuryl 2-Methylcrotonate No suppilers available for the product. |
| Name | Tetrahydrofurfuryl 2-Methylcrotonate |
|---|---|
| Synonyms | Tetrahydrofuran-2-Ylmethyl (E)-2-Methylbut-2-Enoate; (E)-2-Methylbut-2-Enoic Acid 2-Tetrahydrofuranylmethyl Ester; (E)-2-Methylbut-2-Enoic Acid Tetrahydrofurfuryl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 |
| CAS Registry Number | 95873-65-7 |
| EINECS | 306-056-5 |
| SMILES | C(OC(=O)C(=C/C)/C)C1OCCC1 |
| InChI | 1S/C10H16O3/c1-3-8(2)10(11)13-7-9-5-4-6-12-9/h3,9H,4-7H2,1-2H3/b8-3+ |
| InChIKey | HLPPKJYNZGJOBE-FPYGCLRLSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.775°C at 760 mmHg (Cal.) |
| Flash point | 114.698°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetrahydrofurfuryl 2-Methylcrotonate |