|
CAS#: 958885-20-6 Product: (1R,2R,5S,6S)-3,3,4,4-Tetrafluoro-9-oxatricyclo[4.2.1.02,5]non-7-ene No suppilers available for the product. |
| Name | (1R,2R,5S,6S)-3,3,4,4-Tetrafluoro-9-oxatricyclo[4.2.1.02,5]non-7-ene |
|---|---|
| Synonyms | (1S, 4R, |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6F4O |
| Molecular Weight | 194.13 |
| CAS Registry Number | 958885-20-6 |
| SMILES | FC3(F)[C@@H]2[C@H]\1O[C@H](/C=C/1)[C@@H]2C3(F)F |
| InChI | 1S/C8H6F4O/c9-7(10)5-3-1-2-4(13-3)6(5)8(7,11)12/h1-6H/t3-,4+,5+,6- |
| InChIKey | OBMJVYQRSVXUKM-GUCUJZIJSA-N |
| Density | 1.51g/cm3 (Cal.) |
|---|---|
| Boiling point | 177.861°C at 760 mmHg (Cal.) |
| Flash point | 60.193°C (Cal.) |
| Refractive index | 1.457 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R,5S,6S)-3,3,4,4-Tetrafluoro-9-oxatricyclo[4.2.1.02,5]non-7-ene |