Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[2-Methylene-1-(trimethylsilyl)cyclopropyl]ethanone |
|---|---|
| Synonyms | 1-(2-methylene-1-(trimethylsilyl)cyclopropyl)ethanone; 1-[2-Methylene-1-(trimethylsilyl)cyclopropyl]ethanone # |
| Molecular Structure | ![CAS#: 958990-70-0， 1-[2-Methylene-1-(trimethylsilyl)cyclopropyl]ethanone](/moreStructures/958990-70-0.gif) |
| Molecular Formula | C9H16OSi |
| Molecular Weight | 168.31 |
| CAS Registry Number | 958990-70-0 |
| SMILES | O=C(C)C1(\C(=C)C1)[Si](C)(C)C |
| InChI | 1S/C9H16OSi/c1-7-6-9(7,8(2)10)11(3,4)5/h1,6H2,2-5H3 |
| InChIKey | NZSYFRAPXPXYJN-UHFFFAOYSA-N |
| Density | 0.9g/cm3 (Cal.) |
|---|---|
| Boiling point | 189.624°C at 760 mmHg (Cal.) |
| Flash point | 68.482°C (Cal.) |
| Refractive index | 1.448 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-Methylene-1-(trimethylsilyl)cyclopropyl]ethanone |