Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Trimethyl{[1-(2-methylenecyclopropyl)vinyl]oxy}silane |
|---|---|
| Synonyms | 1-(2-Methylenecyclopropyl)vinyl trimethylsilyl ether #; trimethyl((1-(2-methylenecyclopropyl)vinyl)oxy)silane |
| Molecular Structure | ![CAS#: 958990-71-1， Trimethyl{[1-(2-methylenecyclopropyl)vinyl]oxy}silane](/moreStructures/958990-71-1.gif) |
| Molecular Formula | C9H16OSi |
| Molecular Weight | 168.31 |
| CAS Registry Number | 958990-71-1 |
| SMILES | O(/C(=C)C1C(=C)\C1)[Si](C)(C)C |
| InChI | 1S/C9H16OSi/c1-7-6-9(7)8(2)10-11(3,4)5/h9H,1-2,6H2,3-5H3 |
| InChIKey | VXRKNGMBMHAWOR-UHFFFAOYSA-N |
| Density | 0.878g/cm3 (Cal.) |
|---|---|
| Boiling point | 162.742°C at 760 mmHg (Cal.) |
| Flash point | 42.108°C (Cal.) |
| Refractive index | 1.447 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethyl{[1-(2-methylenecyclopropyl)vinyl]oxy}silane |