|
CAS#: 959-10-4 Product: 2-(4-Phenylphenyl)Butanoic Acid No suppilers available for the product. |
| Name | 2-(4-Phenylphenyl)Butanoic Acid |
|---|---|
| Synonyms | 2-(4-Phenylphenyl)Butyric Acid; 4-Biphenylacetic Acid, .Alpha.-Ethyl-; 4-Biphenylylethylacetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 |
| CAS Registry Number | 959-10-4 |
| EINECS | 213-492-9 |
| SMILES | C2=C(C1=CC=CC=C1)C=CC(=C2)C(C(O)=O)CC |
| InChI | 1S/C16H16O2/c1-2-15(16(17)18)14-10-8-13(9-11-14)12-6-4-3-5-7-12/h3-11,15H,2H2,1H3,(H,17,18) |
| InChIKey | IYEPZNKOJZOGJG-UHFFFAOYSA-N |
| Density | 1.113g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.135°C at 760 mmHg (Cal.) |
| Flash point | 296.938°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Phenylphenyl)Butanoic Acid |