Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Allyl(dimethyl)silyl valerate |
|---|---|
| Synonyms | Allyl(dimethyl)silyl pentanoate #; allyldimethylsilyl pentanoate |
| Molecular Structure |  |
| Molecular Formula | C10H20O2Si |
| Molecular Weight | 200.35 |
| CAS Registry Number | 959012-25-0 |
| SMILES | O=C(O[Si](C\C=C)(C)C)CCCC |
| InChI | 1S/C10H20O2Si/c1-5-7-8-10(11)12-13(3,4)9-6-2/h6H,2,5,7-9H2,1,3-4H3 |
| InChIKey | VNJZRAGFYFHPLI-UHFFFAOYSA-N |
| Density | 0.879g/cm3 (Cal.) |
|---|---|
| Boiling point | 201.437°C at 760 mmHg (Cal.) |
| Flash point | 62.963°C (Cal.) |
| Refractive index | 1.428 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Allyl(dimethyl)silyl valerate |