Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Cyclopropyl(trivinyl)silane |
|---|---|
| Synonyms | cyclopropyltrivinylsilane |
| Molecular Structure |  |
| Molecular Formula | C9H14Si |
| Molecular Weight | 150.29 |
| CAS Registry Number | 959074-89-6 |
| SMILES | C(=C)\[Si](\C=C)(\C=C)C1CC1 |
| InChI | 1S/C9H14Si/c1-4-10(5-2,6-3)9-7-8-9/h4-6,9H,1-3,7-8H2 |
| InChIKey | GYCLFDLEPWLTLF-UHFFFAOYSA-N |
| Density | 0.831g/cm3 (Cal.) |
|---|---|
| Boiling point | 158.902°C at 760 mmHg (Cal.) |
| Flash point | 34.983°C (Cal.) |
| Refractive index | 1.462 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclopropyl(trivinyl)silane |