Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Trimethylsilyl 3-oxopentanoate |
|---|---|
| Synonyms | 3-Ketovaleric acid, TMS; 3-Oxopentanoic acid, TMS; trimethylsilyl 3-oxopentanoate |
| Molecular Structure |  |
| Molecular Formula | C8H16O3Si |
| Molecular Weight | 188.30 |
| CAS Registry Number | 959085-77-9 |
| SMILES | O=C(O[Si](C)(C)C)CC(=O)CC |
| InChI | 1S/C8H16O3Si/c1-5-7(9)6-8(10)11-12(2,3)4/h5-6H2,1-4H3 |
| InChIKey | BOPHYICVYUYPGN-UHFFFAOYSA-N |
| Density | 0.956g/cm3 (Cal.) |
|---|---|
| Boiling point | 192.488°C at 760 mmHg (Cal.) |
| Flash point | 58.471°C (Cal.) |
| Refractive index | 1.418 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl 3-oxopentanoate |