Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Astatech, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (215) 785-3197 | |||
|
sales@astatechinc.com | |||
| Chemical manufacturer since 1996 | ||||
| Name | 3-(2,4-Difluorophenyl)pentanedioic acid |
|---|---|
| Synonyms | 3-(2,4-Difluorophenyl)pentanedioic acid; 3-(2,4-Difluoro-phenyl)-pentanedioic acid; 3-(2,4-DIFLUOROPHENYL)PENTANEDIOICACID |
| Molecular Formula | C11H10F2O4 |
| Molecular Weight | 244.19 |
| CAS Registry Number | 959246-68-5 |
| SMILES | Fc1cc(F)ccc1C(CC(O)=O)CC(O)=O |
| InChI | 1S/C11H10F2O4/c12-7-1-2-8(9(13)5-7)6(3-10(14)15)4-11(16)17/h1-2,5-6H,3-4H2,(H,14,15)(H,16,17) |
| InChIKey | QGQUIQKNIOALOU-UHFFFAOYSA-N |
| Density | 1.435g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.147°C at 760 mmHg (Cal.) |
| Flash point | 164.959°C (Cal.) |
| Refractive index | 1.533 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2,4-Difluorophenyl)pentanedioic acid |