Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Trimethyl(2-methylene-3-vinylcyclopropyl)silane |
|---|---|
| Synonyms | Cyclopropane, 1-methylene-2-trimethylsilyl-3-vinyl-, trans-; trimethyl(2-methylene-3-vinylcyclopropyl)silane; Trimethyl(2-methylene-3-vinylcyclopropyl)silane # |
| Molecular Structure |  |
| Molecular Formula | C9H16Si |
| Molecular Weight | 152.31 |
| CAS Registry Number | 959313-08-7 |
| SMILES | C=C\C1\C(=C)C1[Si](C)(C)C |
| InChI | 1S/C9H16Si/c1-6-8-7(2)9(8)10(3,4)5/h6,8-9H,1-2H2,3-5H3 |
| InChIKey | QJIIUBPXNWULEZ-UHFFFAOYSA-N |
| Density | 0.819g/cm3 (Cal.) |
|---|---|
| Boiling point | 153.449°C at 760 mmHg (Cal.) |
| Flash point | 31.654°C (Cal.) |
| Refractive index | 1.447 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethyl(2-methylene-3-vinylcyclopropyl)silane |