|
CAS#: 959928-89-3 Product: Ethyl 4-(2-pyrimidinylamino)benzoate No suppilers available for the product. |
| Name | Ethyl 4-(2-pyrimidinylamino)benzoate |
|---|---|
| Synonyms | 4-(Pyrimidin-2-ylamino)benzoic acid ethyl ester |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.26 |
| CAS Registry Number | 959928-89-3 |
| SMILES | CCOC(=O)c1ccc(cc1)Nc2ncccn2 |
| InChI | 1S/C13H13N3O2/c1-2-18-12(17)10-4-6-11(7-5-10)16-13-14-8-3-9-15-13/h3-9H,2H2,1H3,(H,14,15,16) |
| InChIKey | QZNMTAJPWIVICE-UHFFFAOYSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.565°C at 760 mmHg (Cal.) |
| Flash point | 205.126°C (Cal.) |
| Refractive index | 1.612 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-(2-pyrimidinylamino)benzoate |