| Chemfish Tokyo Co., Ltd. | Japan | Inquire | ||
|---|---|---|---|---|
![]() | www.chemfish.co.jp | |||
![]() | +080 46541159 | |||
![]() | sunnyjiao@chemfish.co.jp | |||
| Chemical distributor since 2012 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Name | Dinsed |
|---|---|
| Synonyms | 3-Nitro-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]benzenesulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C35H28O11 |
| Molecular Weight | 430.41 |
| CAS Registry Number | 96-62-8 |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NCCNS(=O)(=O)C2=CC=CC(=C2)[N+](=O)[O-])[N+](=O)[O-] |
| Solubility | 120.6 mg/L (25 °C water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.629, Calc.* |
| Melting point | 265.39 °C |
| Boiling Point | 613.01 °C, 659.9±65.0 °C (760 mmHg), Calc.* |
| Flash Point | 352.9±34.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Dinsed |