|
CAS#: 96196-27-9 Product: 4-(4-Amino-2-Methylphenyl)-3-Methylaniline Hydrochloride No suppilers available for the product. |
| Name | 4-(4-Amino-2-Methylphenyl)-3-Methylaniline Hydrochloride |
|---|---|
| Synonyms | 4-(4-Amino-2-Methyl-Phenyl)-3-Methyl-Aniline Hydrochloride; M-Tolidine Hydrochloride; 2,2'-Dimethylbenzidine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.75 |
| CAS Registry Number | 96196-27-9 |
| SMILES | [H+].C1=CC(=CC(=C1C2=C(C=C(N)C=C2)C)C)N.[Cl-] |
| InChI | 1S/C14H16N2.ClH/c1-9-7-11(15)3-5-13(9)14-6-4-12(16)8-10(14)2;/h3-8H,15-16H2,1-2H3;1H |
| InChIKey | CZFJZGCNFULLBI-UHFFFAOYSA-N |
| Boiling point | 344.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Amino-2-Methylphenyl)-3-Methylaniline Hydrochloride |