Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(Trifluoroacetyl)-2(1H)-pyridinone |
|---|---|
| Synonyms | 1-(2,2,2-trifluoroacetyl)pyridin-2(1H)-one |
| Molecular Structure |  |
| Molecular Formula | C7H4F3NO2 |
| Molecular Weight | 191.11 |
| CAS Registry Number | 96254-06-7 |
| SMILES | c1ccn(c(=O)c1)C(=O)C(F)(F)F |
| InChI | 1S/C7H4F3NO2/c8-7(9,10)6(13)11-4-2-1-3-5(11)12/h1-4H |
| InChIKey | KOCJEUOJVXPDRH-UHFFFAOYSA-N |
| Density | 1.49g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.933°C at 760 mmHg (Cal.) |
| Flash point | 91.046°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Trifluoroacetyl)-2(1H)-pyridinone |