Online Database of Chemicals from Around the World
|
CAS#: 963-22-4 Product: 2,4-dinitro-1-pentylsulfonyl-benzene No suppilers available for the product. |
| Name | 2,4-dinitro-1-pentylsulfonyl-benzene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.30 |
| CAS Registry Number | 963-22-4 |
| SMILES | O=S(=O)(CCCCC)c1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C11H14N2O6S/c1-2-3-4-7-20(18,19)11-6-5-9(12(14)15)8-10(11)13(16)17/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | PTWBGBDKDZWGCL-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.965°C at 760 mmHg (Cal.) |
| Flash point | 248.308°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-dinitro-1-pentylsulfonyl-benzene |