Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl (1R,2S)-2-isopropenylcyclopropanecarboxylate |
|---|---|
| Synonyms | (1R,2S)-methyl 2-(prop-1-en-2-yl)cyclopropanecarboxylate |
| Molecular Structure |  |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 |
| CAS Registry Number | 96358-64-4 |
| SMILES | CC(=C)[C@H]1C[C@H]1C(=O)OC |
| InChI | 1S/C8H12O2/c1-5(2)6-4-7(6)8(9)10-3/h6-7H,1,4H2,2-3H3/t6-,7-/m1/s1 |
| InChIKey | LMBOQANNXZNCTJ-RNFRBKRXSA-N |
| Density | 1.028g/cm3 (Cal.) |
|---|---|
| Boiling point | 158.327°C at 760 mmHg (Cal.) |
| Flash point | 39.09°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (1R,2S)-2-isopropenylcyclopropanecarboxylate |