|
CAS#: 964-82-9 Product: Xenyhexenic No suppilers available for the product. |
| Name | Xenyhexenic |
|---|---|
| Synonyms | (1,1'-Biphenyl)-4-Acetic Acid, Alpha-2-Butenyl-; 2-(4-Biphenylyl)-4-Hexenoic Acid; 2-(4-Biphenylyl)-4-Hexensaeure |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 964-82-9 |
| SMILES | C1=CC(=CC=C1C(C/C=C/C)C(O)=O)C2=CC=CC=C2 |
| InChI | 1S/C18H18O2/c1-2-3-9-17(18(19)20)16-12-10-15(11-13-16)14-7-5-4-6-8-14/h2-8,10-13,17H,9H2,1H3,(H,19,20)/b3-2+ |
| InChIKey | ZVRCODPBROUJIT-NSCUHMNNSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.458°C at 760 mmHg (Cal.) |
| Flash point | 324.174°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Xenyhexenic |