Online Database of Chemicals from Around the World
|
CAS#: 96684-29-6 Product: 4-Iodophentermine No suppilers available for the product. |
| Name | 4-Iodophentermine |
|---|---|
| Synonyms | 1-(4-Iodophenyl)-2-Methyl-Propan-2-Amine; [2-(4-Iodophenyl)-1,1-Dimethyl-Ethyl]Amine; 4-Iodophentermine |
| Molecular Structure |  |
| Molecular Formula | C10H14IN |
| Molecular Weight | 275.13 |
| CAS Registry Number | 96684-29-6 |
| SMILES | C1=C(C=CC(=C1)CC(N)(C)C)I |
| InChI | 1S/C10H14IN/c1-10(2,12)7-8-3-5-9(11)6-4-8/h3-6H,7,12H2,1-2H3 |
| InChIKey | OFSPKQNLMJRFGF-UHFFFAOYSA-N |
| Density | 1.52g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.938°C at 760 mmHg (Cal.) |
| Flash point | 126.731°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Iodophentermine |