Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(1S,2S,3S)-2,3-Dichlorocyclobutyl]ethanone |
|---|---|
| Synonyms | 1-((1S,2S,3S)-2,3-dichlorocyclobutyl)ethanone |
| Molecular Structure | ![CAS#: 96688-36-7， 1-[(1S,2S,3S)-2,3-Dichlorocyclobutyl]ethanone](/moreStructures/96688-36-7.gif) |
| Molecular Formula | C6H8Cl2O |
| Molecular Weight | 167.03 |
| CAS Registry Number | 96688-36-7 |
| SMILES | CC(=O)[C@@H]1C[C@@H]([C@H]1Cl)Cl |
| InChI | 1S/C6H8Cl2O/c1-3(9)4-2-5(7)6(4)8/h4-6H,2H2,1H3/t4-,5-,6-/m0/s1 |
| InChIKey | ZOEKLVCPCXYQSX-ZLUOBGJFSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 240.2±40.0°C at 760 mmHg (Cal.) |
| Flash point | 97.8±27.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1S,2S,3S)-2,3-Dichlorocyclobutyl]ethanone |