Online Database of Chemicals from Around the World
|
CAS#: 96737-55-2 Product: 18-Hydroxycortisone No suppilers available for the product. |
| Name | 18-Hydroxycortisone |
|---|---|
| Synonyms | (8S,9S,10R,13S,14S,17R)-17-Hydroxy-13-(Hydroxymethyl)-17-(2-Hydroxy-1-Oxoethyl)-10-Methyl-1,2,6,7,8,9,12,14,15,16-Decahydrocyclopenta[A]Phenanthrene-3,11-Dione; (8S,9S,10R,13S,14S,17R)-17-Glycoloyl-17-Hydroxy-10-Methyl-13-Methylol-1,2,6,7,8,9,12,14,15,16-D |
| Molecular Structure |  |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 |
| CAS Registry Number | 96737-55-2 |
| SMILES | [C@H]34[C@H]2[C@@H]([C@@]1(C(=CC(=O)CC1)CC2)C)C(=O)C[C@@]3([C@](O)(CC4)C(=O)CO)CO |
| InChI | 1S/C21H28O6/c1-19-6-4-13(24)8-12(19)2-3-14-15-5-7-21(27,17(26)10-22)20(15,11-23)9-16(25)18(14)19/h8,14-15,18,22-23,27H,2-7,9-11H2,1H3/t14-,15-,18+,19-,20+,21-/m0/s1 |
| InChIKey | FPYGQPQXGSIDSF-RBWSHPMZSA-N |
| Density | 1.356g/cm3 (Cal.) |
|---|---|
| Boiling point | 618.033°C at 760 mmHg (Cal.) |
| Flash point | 341.591°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 18-Hydroxycortisone |