Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | (2R,3S)-2-(Hydroxymethyl)-2,3-dihydrofuran-3-ol |
|---|---|
| Synonyms | (2R,3S)-2-Methylol-2,3-Dihydrofuran-3-Ol; Inchi=1/C5h8o3/C6-3-5-4(7)1-2-8-5/H1-2,4-7H,3H2/T4-,5+/M0/S; 1,4-Anhydro-2-Deoxy-D-Erythro-Pent-1-Enitol |
| Molecular Structure |  |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 |
| CAS Registry Number | 96761-00-1 |
| SMILES | [C@@H]1(C=CO[C@@H]1CO)O |
| InChI | 1S/C5H8O3/c6-3-5-4(7)1-2-8-5/h1-2,4-7H,3H2/t4-,5+/m0/s1 |
| InChIKey | SGOSIWMWLVSBIC-CRCLSJGQSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.925°C at 760 mmHg (Cal.) |
| Flash point | 111.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3S)-2-(Hydroxymethyl)-2,3-dihydrofuran-3-ol |