Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4,6-Dihydroxy-3-biphenylcarbonitrile |
|---|---|
| Synonyms | 4,6-dihydroxy-[1,1'-biphenyl]-3-carbonitrile |
| Molecular Structure |  |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 |
| CAS Registry Number | 96802-39-0 |
| SMILES | c1ccc(cc1)c2cc(c(cc2O)O)C#N |
| InChI | 1S/C13H9NO2/c14-8-10-6-11(13(16)7-12(10)15)9-4-2-1-3-5-9/h1-7,15-16H |
| InChIKey | WPTWITLAXPCMCO-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.348°C at 760 mmHg (Cal.) |
| Flash point | 212.858°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dihydroxy-3-biphenylcarbonitrile |