Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Oxocycloheptanesulfonamide |
|---|---|
| Synonyms | 2-oxocycloheptane-1-sulfonamide |
| Molecular Structure |  |
| Molecular Formula | C7H13NO3S |
| Molecular Weight | 191.25 |
| CAS Registry Number | 96855-97-9 |
| SMILES | C1CCC(C(=O)CC1)S(=O)(=O)N |
| InChI | 1S/C7H13NO3S/c8-12(10,11)7-5-3-1-2-4-6(7)9/h7H,1-5H2,(H2,8,10,11) |
| InChIKey | VYVHBEDXEGDWNT-UHFFFAOYSA-N |
| Density | 1.298g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.783°C at 760 mmHg (Cal.) |
| Flash point | 182.882°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Oxocycloheptanesulfonamide |