Online Database of Chemicals from Around the World
|
CAS#: 97-81-4 Product: 5,6-Epoxynorbornane-2-carboxylic acid ethyl ester No suppilers available for the product. |
| Name | 5,6-Epoxynorbornane-2-carboxylic acid ethyl ester |
|---|---|
| Synonyms | 3,4-Epoxy-2,5-Endomethylenecyclohexanecarboxylic Acid, Ethyl Ester; 3-Oxatricyclo(3.2.1.0(2,4))Octane-6-Carboxylic Acid, Ethyl Ester; 3-Oxatricyclo(3.2.1.0(Sup 2,4))Octane-6-Carboxylic Acid, Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 |
| CAS Registry Number | 97-81-4 |
| SMILES | C(OC(=O)C3C2C1OC1C(C2)C3)C |
| InChI | 1S/C10H14O3/c1-2-12-10(11)7-4-5-3-6(7)9-8(5)13-9/h5-9H,2-4H2,1H3 |
| InChIKey | DKVJAOMZYNDXCB-UHFFFAOYSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.369°C at 760 mmHg (Cal.) |
| Flash point | 98.443°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Epoxynorbornane-2-carboxylic acid ethyl ester |