Online Database of Chemicals from Around the World
|
CAS#: 97234-38-3 Product: 1-[1-(1-Hydroxybutyl)cyclopentyl]-2-phenylethanone No suppilers available for the product. |
| Name | 1-[1-(1-Hydroxybutyl)cyclopentyl]-2-phenylethanone |
|---|---|
| Molecular Structure | ![CAS#: 97234-38-3， 1-[1-(1-Hydroxybutyl)cyclopentyl]-2-phenylethanone](/moreStructures/97234-38-3.gif) |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.37 |
| CAS Registry Number | 97234-38-3 |
| SMILES | O=C(C1(C(O)CCC)CCCC1)Cc2ccccc2 |
| InChI | 1S/C17H24O2/c1-2-8-15(18)17(11-6-7-12-17)16(19)13-14-9-4-3-5-10-14/h3-5,9-10,15,18H,2,6-8,11-13H2,1H3 |
| InChIKey | PQORQXIDHJKRBM-UHFFFAOYSA-N |
| Density | 1.062g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.846°C at 760 mmHg (Cal.) |
| Flash point | 164.759°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[1-(1-Hydroxybutyl)cyclopentyl]-2-phenylethanone |