Online Database of Chemicals from Around the World
|
CAS#: 97509-29-0 Product: 1,2-Dihydroxy-9-Nitro-1,2-Dihydroanthracene No suppilers available for the product. |
| Name | 1,2-Dihydroxy-9-Nitro-1,2-Dihydroanthracene |
|---|---|
| Synonyms | 1,2-Dihydroxy-9-Nitro-1,2-Dihydroanthracene; Ccris 5505; Trans-1,2-Dihydroxy-9-Nitro-1,2-Dihydroanthracene |
| Molecular Structure |  |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 |
| CAS Registry Number | 97509-29-0 |
| SMILES | [C@@H]1([C@@H](C=CC2=C1C(=C3C(=C2)C=CC=C3)[N+](=O)[O-])O)O |
| InChI | 1S/C14H11NO4/c16-11-6-5-9-7-8-3-1-2-4-10(8)13(15(18)19)12(9)14(11)17/h1-7,11,14,16-17H/t11-,14+/m1/s1 |
| InChIKey | QSXWJHDDFBXFHY-RISCZKNCSA-N |
| Density | 1.518g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.583°C at 760 mmHg (Cal.) |
| Flash point | 203.915°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydroxy-9-Nitro-1,2-Dihydroanthracene |