|
CAS#: 97635-56-8 Product: (2S)-2,6-diaminohexanoic acid, (2S)-5-oxopyrrolidine-2-carboxylic acid No suppilers available for the product. |
| Classification | Biochemical >> Amino acids and their derivatives >> Lysine derivative |
|---|---|
| Name | (2S)-2,6-diaminohexanoic acid, (2S)-5-oxopyrrolidine-2-carboxylic acid |
| Synonyms | 5-oxo-DL-proline, compound with DL-lysine (1:1); 5-oxo-DL-proline, compound with L-lysine (1:1); 5-oxo-L-proline, compound with DL-lysine (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.30 |
| CAS Registry Number | 97635-56-8 |
| EINECS | 307-418-5 |
| SMILES | OC(=O)[C@@H]1CCC(=O)N1.NCCCC[C@H](N)C(O)=O |
| InChI | 1S/C6H14N2O2.C5H7NO3/c7-4-2-1-3-5(8)6(9)10;7-4-2-1-3(6-4)5(8)9/h5H,1-4,7-8H2,(H,9,10);3H,1-2H2,(H,6,7)(H,8,9)/t5-;3-/m00/s1 |
| InChIKey | GSTSUZHIVMCRLR-RVZXSAGBSA-N |
| Boiling point | 624.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 331.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2,6-diaminohexanoic acid, (2S)-5-oxopyrrolidine-2-carboxylic acid |