Online Database of Chemicals from Around the World
|
CAS#: 97744-84-8 Product: 4-Bromomethyl-6,7-Methylenedioxycoumarin No suppilers available for the product. |
| Name | 4-Bromomethyl-6,7-Methylenedioxycoumarin |
|---|---|
| Synonyms | 8-(Bromomethyl)-6-Pyrano[6,5-F][1,3]Benzodioxolone; 4-Bromomethyl-6,7-Methylenedioxycoumarin; 6H-1,3-Dioxolo(4,5-G)(1)Benzopyran-6-One, 8-(Bromomethyl)- |
| Molecular Structure |  |
| Molecular Formula | C11H7BrO4 |
| Molecular Weight | 283.08 |
| CAS Registry Number | 97744-84-8 |
| SMILES | C1=C3C(=CC2=C1OC(C=C2CBr)=O)OCO3 |
| InChI | 1S/C11H7BrO4/c12-4-6-1-11(13)16-8-3-10-9(2-7(6)8)14-5-15-10/h1-3H,4-5H2 |
| InChIKey | NCAGFJSHHAMSLJ-UHFFFAOYSA-N |
| Density | 1.764g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.779°C at 760 mmHg (Cal.) |
| Flash point | 204.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromomethyl-6,7-Methylenedioxycoumarin |