Online Database of Chemicals from Around the World
|
CAS#: 98088-95-0 Product: N,N'-(3-Methylbutylidene)Bismethacrylamide No suppilers available for the product. |
| Name | N,N'-(3-Methylbutylidene)Bismethacrylamide |
|---|---|
| Synonyms | 2-Methyl-N-[3-Methyl-1-[(2-Methyl-1-Oxoprop-2-Enyl)Amino]Butyl]Prop-2-Enamide; N-(1-Methacrylamido-3-Methyl-Butyl)-2-Methyl-Acrylamide |
| Molecular Structure |  |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 |
| CAS Registry Number | 98088-95-0 |
| EINECS | 308-568-4 |
| SMILES | C(C(NC(C(=C)C)=O)NC(C(=C)C)=O)C(C)C |
| InChI | 1S/C13H22N2O2/c1-8(2)7-11(14-12(16)9(3)4)15-13(17)10(5)6/h8,11H,3,5,7H2,1-2,4,6H3,(H,14,16)(H,15,17) |
| InChIKey | WMCQRSRSFMERMW-UHFFFAOYSA-N |
| Density | 0.971g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.24°C at 760 mmHg (Cal.) |
| Flash point | 174.556°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-(3-Methylbutylidene)Bismethacrylamide |