Online Database of Chemicals from Around the World
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (386) 462-0788 | |||
 |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (845) 299-6009/ | |||
|
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2,2,2-Trichloroethyl 2-fluoroacrylate |
|---|---|
| Synonyms | 2,2,2-Trichloroethyl 2-fluoroacrylate; 2,2,2-trichloroethyl 2-fluoroprop-2-enoate; 2,2,2-Trichloroethyl-2-fluoroacrylate |
| Molecular Structure |  |
| Molecular Formula | C5H4Cl3FO2 |
| Molecular Weight | 221.44 |
| CAS Registry Number | 98120-00-4 |
| SMILES | ClC(Cl)(Cl)COC(=O)C(\F)=C |
| InChI | 1S/C5H4Cl3FO2/c1-3(9)4(10)11-2-5(6,7)8/h1-2H2 |
| InChIKey | RLBUOZNCCZTWOK-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 233.279°C at 760 mmHg (Cal.) |
| 46°C (Expl.) | |
| Flash point | 98.251°C (Cal.) |
| Safety Description | Irritant |
|---|---|
| S23,S24/25,S36/37/39,S45 | |
| R36/37/38 | |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trichloroethyl 2-fluoroacrylate |