| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.worldyachem.com | |||
![]() | +86 13651600618 +86 (21) 5679-5779 | |||
![]() | +86 (21) 5679-5266 | |||
![]() | sales7777@worldyachem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 13651600618 | |||
![]() | WhatsApp:+86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| Name | Isomenthol |
|---|---|
| Synonyms | (1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 |
| CAS Registry Number | 98167-53-4 |
| EC Number | 207-722-7 |
| SMILES | C[C@H]1CC[C@H]([C@@H](C1)O)C(C)C |
| Solubility | 434.5 mg/L (25 °C water) |
|---|---|
| Density | 0.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.457, Calc.* |
| Melting point | -5.90 °C |
| Boiling Point | 218.94 °C, 215.4±8.0 °C (760 mmHg), Calc.* |
| Flash Point | 93.3±0.0 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Isomenthol |