|
CAS#: 98258-72-1 Product: 4-(3-Oxo-3-Phenyl-1-Propen-1-Yl)Benzoic Acid Methyl Ester No suppilers available for the product. |
| Name | 4-(3-Oxo-3-Phenyl-1-Propen-1-Yl)Benzoic Acid Methyl Ester |
|---|---|
| Synonyms | Methyl 4-[(E)-3-Oxo-3-Phenylprop-1-Enyl]Benzoate; Methyl 4-(3-Oxo-3-Phenyl-Prop-1-Enyl)Benzoate; Methyl 4-[(E)-3-Oxo-3-Phenyl-Prop-1-Enyl]Benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 |
| CAS Registry Number | 98258-72-1 |
| SMILES | C1=C(C=CC(=C1)\C=C\C(C2=CC=CC=C2)=O)C(OC)=O |
| InChI | 1S/C17H14O3/c1-20-17(19)15-10-7-13(8-11-15)9-12-16(18)14-5-3-2-4-6-14/h2-12H,1H3/b12-9+ |
| InChIKey | CADDVOXTZYEXKQ-FMIVXFBMSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.31°C at 760 mmHg (Cal.) |
| Flash point | 189.474°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Oxo-3-Phenyl-1-Propen-1-Yl)Benzoic Acid Methyl Ester |