|
CAS#: 98322-65-7 Product: trans-4-(4-Chlorophenyl)cyclohexanol No suppilers available for the product. |
| Name | trans-4-(4-Chlorophenyl)cyclohexanol |
|---|---|
| Synonyms | Cyclohexanol, 4-(4-chlorophenyl)-, trans-; trans-4-(4-Chlorophenyl)cyclohexanol; trans-4-(4-Chlorophényl)cyclohexanol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.70 |
| CAS Registry Number | 98322-65-7 |
| SMILES | c1c(ccc(c1)Cl)[C@H]2CC[C@@H](CC2)O |
| InChI | 1S/C12H15ClO/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-2,5-6,10,12,14H,3-4,7-8H2/t10-,12- |
| InChIKey | LKOIMBDVTMGGHH-UMSPYCQHSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.2±42.0°C at 760 mmHg (Cal.) |
| Flash point | 150.5±27.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-4-(4-Chlorophenyl)cyclohexanol |