Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 | |||
 |
info@purerechem.com | |||
 |
QQ Chat | |||
 |
Skype Chat | |||
| Chemical manufacturer since 2018 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | N-[4-(Benzyloxy)cyclohexyl]-5-chloropentanamide |
|---|---|
| Synonyms | trans-5-Chloro-N-[4-(phenylmethoxy)cyclohexyl]pentanamide |
| Molecular Structure | ![CAS#: 98454-45-6， N-[4-(Benzyloxy)cyclohexyl]-5-chloropentanamide](/moreStructures/98454-45-6.gif) |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 |
| CAS Registry Number | 98454-45-6 |
| SMILES | c1ccc(cc1)COC2CCC(CC2)NC(=O)CCCCCl |
| InChI | 1S/C18H26ClNO2/c19-13-5-4-8-18(21)20-16-9-11-17(12-10-16)22-14-15-6-2-1-3-7-15/h1-3,6-7,16-17H,4-5,8-14H2,(H,20,21) |
| InChIKey | HJFOCXDRFIKMQK-UHFFFAOYSA-N |
| Density | 1.111g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.313°C at 760 mmHg (Cal.) |
| Flash point | 255.776°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(Benzyloxy)cyclohexyl]-5-chloropentanamide |