Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Isopropyl-3,5,6-indolinetriol |
|---|---|
| Synonyms | 1-isopropylindoline-3,5,6-triol |
| Molecular Structure |  |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 |
| CAS Registry Number | 98496-30-1 |
| SMILES | CC(C)N1CC(c2c1cc(c(c2)O)O)O |
| InChI | 1S/C11H15NO3/c1-6(2)12-5-11(15)7-3-9(13)10(14)4-8(7)12/h3-4,6,11,13-15H,5H2,1-2H3 |
| InChIKey | BEIUVJDBUQYVOV-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.933°C at 760 mmHg (Cal.) |
| Flash point | 262.476°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Isopropyl-3,5,6-indolinetriol |