Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 | |||
 |
info@purerechem.com | |||
 |
QQ Chat | |||
 |
Skype Chat | |||
| Chemical manufacturer since 2018 | ||||
| chemBlink standard supplier since 2023 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
|
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Methyl-2-pyrazinecarboxylic acid 1-oxide |
|---|---|
| Synonyms | 2-carboxy-5-methylpyrazine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12 |
| CAS Registry Number | 98502-96-6 |
| SMILES | Cc1c[n+](c(cn1)C(=O)O)[O-] |
| InChI | 1S/C6H6N2O3/c1-4-3-8(11)5(2-7-4)6(9)10/h2-3H,1H3,(H,9,10) |
| InChIKey | CLXREMDHRROEST-UHFFFAOYSA-N |
| Density | 1.44g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.512°C at 760 mmHg (Cal.) |
| Flash point | 261.339°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2-pyrazinecarboxylic acid 1-oxide |