|
CAS#: 98516-19-9 Product: Cis-2-Benzylaminomethyl-1-Cycloheptanol Hydrochloride No suppilers available for the product. |
| Name | Cis-2-Benzylaminomethyl-1-Cycloheptanol Hydrochloride |
|---|---|
| Synonyms | [(1S,2S)-2-Hydroxycycloheptyl]Methyl-(Phenylmethyl)Ammonium; Benzyl-[[(1S,2S)-2-Hydroxycycloheptyl]Methyl]Ammonium; Zinc04262560 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24NO |
| Molecular Weight | 234.36 |
| CAS Registry Number | 98516-19-9 |
| SMILES | [C@@H]1([C@@H](O)CCCCC1)C[NH2+]CC2=CC=CC=C2 |
| InChI | 1S/C15H23NO/c17-15-10-6-2-5-9-14(15)12-16-11-13-7-3-1-4-8-13/h1,3-4,7-8,14-17H,2,5-6,9-12H2/p+1/t14-,15-/m0/s1 |
| InChIKey | MZZVUVBTOHLLKV-GJZGRUSLSA-O |
| Boiling point | 364.041°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 102.767°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cis-2-Benzylaminomethyl-1-Cycloheptanol Hydrochloride |