Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-[(R)-Methylsulfinyl]-1H-benzimidazole |
|---|---|
| Synonyms | (R)-2-(methylsulfinyl)-1H-benzo[d]imidazole |
| Molecular Structure | ![CAS#: 98639-91-9， 2-[(R)-Methylsulfinyl]-1H-benzimidazole](/moreStructures/98639-91-9.gif) |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 |
| CAS Registry Number | 98639-91-9 |
| SMILES | C[S@@](=O)C1=NC2=CC=CC=C2N1 |
| InChI | 1S/C8H8N2OS/c1-12(11)8-9-6-4-2-3-5-7(6)10-8/h2-5H,1H3,(H,9,10)/t12-/m1/s1 |
| InChIKey | KWUOZCQDBYFKRM-GFCCVEGCSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.1±28.0°C at 760 mmHg (Cal.) |
| Flash point | 210.3±24.0°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(R)-Methylsulfinyl]-1H-benzimidazole |