| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 7,7-Dimethyl-1-[(trihydroxy-lambda4-sulfanyl)methyl]bicyclo[2.2.1]heptan-2-one hydrate (1:1) |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H20O5S |
| Molecular Weight | 252.33 |
| CAS Registry Number | 98673-87-1 |
| SMILES | O.CC2(C)C1CC(=O)C2(CC1)CS(O)(O)O |
| InChI | 1S/C10H18O4S.H2O/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;/h7,12-14H,3-6H2,1-2H3;1H2 |
| InChIKey | UQJZWASSJDESLV-UHFFFAOYSA-N |
| Melting point | 194°C (Expl.) |
|---|---|
| Safety Description | DANGER: CORROSIVE, burns skin and eyes |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 7,7-Dimethyl-1-[(trihydroxy-lambda4-sulfanyl)methyl]bicyclo[2.2.1]heptan-2-one hydrate (1:1) |