| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2-Ethynylquinoxaline |
|---|---|
| Synonyms | 2-ethynylquinoxaline; InChI=1/C10H6N2/c1-2-8-7-11-9-5-3-4-6-10(9)12-8/h1,3-7H |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6N2 |
| Molecular Weight | 154.17 |
| CAS Registry Number | 98813-70-8 |
| SMILES | C#CC1=NC2=CC=CC=C2N=C1 |
| InChI | 1S/C10H6N2/c1-2-8-7-11-9-5-3-4-6-10(9)12-8/h1,3-7H |
| InChIKey | DSBXCMSDHQSXAW-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.8±20.0°C at 760 mmHg (Cal.) |
| Flash point | 123.7±13.1°C (Cal.) |
| (1) | Montserrat Armengol and John A. Joule. Synthesis of thieno[2,3-b]quinoxalines from 2-haloquinoxalines, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 154. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Ethynylquinoxaline |