Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2Z)-3-Ethoxy-2-nitroacrylamide |
|---|---|
| Synonyms | (Z)-3-ethoxy-2-nitroacrylamide; 2-Propenamide, 3-ethoxy-2-nitro- |
| Molecular Structure |  |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 |
| CAS Registry Number | 98895-22-8 |
| SMILES | CCO/C=C(/C(=O)N)\[N+](=O)[O-] |
| InChI | 1S/C5H8N2O4/c1-2-11-3-4(5(6)8)7(9)10/h3H,2H2,1H3,(H2,6,8)/b4-3- |
| InChIKey | WTAXTRYSKFHZNJ-ARJAWSKDSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.595°C at 760 mmHg (Cal.) |
| Flash point | 165.834°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z)-3-Ethoxy-2-nitroacrylamide |