Online Database of Chemicals from Around the World
|
CAS#: 98950-45-9 Product: 4-Chlorobenzyloxybiguanide No suppilers available for the product. |
| Name | 4-Chlorobenzyloxybiguanide |
|---|---|
| Synonyms | 2-[(4-Chlorophenyl)Methoxy]-1-(Diaminomethylene)Guanidine; 2-(4-Chlorobenzyl)Oxy-1-(Diaminomethylene)Guanidine; 4-Chlorobenzyloxybiguanide |
| Molecular Structure |  |
| Molecular Formula | C9H12ClN5O |
| Molecular Weight | 241.68 |
| CAS Registry Number | 98950-45-9 |
| SMILES | C1=C(CO\N=C(N=C(N)N)/N)C=CC(=C1)Cl |
| InChI | 1S/C9H12ClN5O/c10-7-3-1-6(2-4-7)5-16-15-9(13)14-8(11)12/h1-4H,5H2,(H6,11,12,13,14,15) |
| InChIKey | CSHFMVWINHMKQU-UHFFFAOYSA-N |
| Density | 1.468g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.354°C at 760 mmHg (Cal.) |
| Flash point | 218.304°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chlorobenzyloxybiguanide |